CAS 107802-80-2
:METHYL 2,3,4-TRI-O-BENZYL-1-THIO-BETA-L-FUCOPYRANOSIDE
Description:
Methyl 2,3,4-tri-O-benzyl-1-thio-beta-L-fucopyranoside is a complex carbohydrate derivative, specifically a thio-glycoside, which features a fucose sugar moiety modified with benzyl protecting groups. This compound is characterized by its unique structural features, including the presence of a thioether linkage, which enhances its reactivity and stability compared to typical glycosides. The benzyl groups serve as protecting groups for the hydroxyl functionalities on the fucose ring, allowing for selective reactions in synthetic chemistry. This compound is often utilized in carbohydrate chemistry for the synthesis of more complex oligosaccharides and glycoproteins, as it can be further manipulated through various chemical reactions. Its properties, such as solubility and reactivity, are influenced by the presence of the benzyl groups and the thioether bond, making it a valuable intermediate in the development of glycosylated compounds. Additionally, its structural complexity and functional groups make it a subject of interest in studies related to glycoscience and medicinal chemistry.
Formula:C28H32O4S
InChI:InChI=1/C28H32O4S/c1-21-25(29-18-22-12-6-3-7-13-22)26(30-19-23-14-8-4-9-15-23)27(28(32-21)33-2)31-20-24-16-10-5-11-17-24/h3-17,21,25-28H,18-20H2,1-2H3/t21-,25+,26+,27-,28+/m0/s1
Synonyms:- Methyl2,3,4-tri-O-benzyl-b-L-thiofucopyranoside
- methyl 2,3,4-tri-O-benzyl-6-deoxy-1-thio-beta-L-galactopyranoside
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
Methyl 2,3,4-Tri-O-benzyl-1-thio-β-L-fucopyranoside
CAS:Formula:C28H32O4SPurity:95.0%Molecular weight:464.6163Methyl 2,3,4-Tri-O-benzyl-1-thio-β-L-fucopyranoside
CAS:Methyl 2,3,4-Tri-O-benzyl-1-thio-β-L-fucopyranosidePurity:>95.0%Methyl 2,3,4-Tri-O-benzyl-1-thio-β-L-fucopyranoside
CAS:Formula:C28H32O4SPurity:>95.0%(HPLC)Color and Shape:White to Almost white powder to crystalMolecular weight:464.62Methyl 2,3,4-tri-O-benzyl-b-L-thiofucopyranoside
CAS:<p>Methyl 2,3,4-tri-O-benzyl-b-L-thiofucopyranoside is a glycosyl acceptor that can be used in the synthesis of oligosaccharides. It is also an intermediate for the production of antifungal drugs such as fluconazole.</p>Formula:C28H32O4SPurity:Min. 95%Molecular weight:464.62 g/mol




