CAS 107807-24-9
:epelmycin B
Description:
Epelmycin B is a natural product belonging to the class of macrolide antibiotics, specifically derived from the fermentation of certain Streptomyces species. It exhibits a complex structure characterized by a large lactone ring, which is typical of macrolides, and contains multiple functional groups that contribute to its biological activity. Epelmycin B is known for its antimicrobial properties, particularly against a range of Gram-positive bacteria and some fungi, making it of interest in pharmaceutical applications. Its mechanism of action generally involves inhibition of protein synthesis by binding to the bacterial ribosome. The compound is also noted for its potential in cancer research due to its cytotoxic effects on certain tumor cell lines. As with many antibiotics, the development of resistance is a concern, necessitating ongoing research into its efficacy and potential modifications to enhance its therapeutic profile. Safety and toxicity profiles are critical for its use, and further studies are often required to fully understand its pharmacokinetics and pharmacodynamics.
Formula:C42H51NO16
InChI:InChI=1/C42H51NO16/c1-8-42(51)15-25(29-30(33(42)40(50)52-7)37(49)31-32(36(29)48)35(47)28-19(34(31)46)10-9-11-21(28)44)57-26-12-20(43(5)6)38(17(3)53-26)58-27-14-23-39(18(4)54-27)59-41-24(56-23)13-22(45)16(2)55-41/h9-11,16-18,20,23-27,33,38-39,41,44,48-49,51H,8,12-15H2,1-7H3
Synonyms:- 1-Naphthacenecarboxylic acid, 4-[[[2''',3''-anhydro]-O-3,6-dideoxy-α-L-erythro-hexopyranos-4-ulos-1-yl-(1→4)-O-2,6-dideoxy-α-L-lyxo-hexopyranosyl-(1→4)-2,3,6-trideoxy-3-(dimethylamino)-α-L-lyxo-hexopyranosyl]oxy]-2-ethyl-1,2,3,4,6,11-hexahydro-2,5,7,12-tetrahydroxy-6,11-dioxo-, methyl ester
- epelmycin B
- Epelmycin B
- methyl 4-({4-(dimethylamino)-5-[(2,9-dimethyl-3-oxooctahydro-2H,5aH-dipyrano[2,3-b:4',3'-e][1,4]dioxin-7-yl)oxy]-6-methyltetrahydro-2H-pyran-2-yl}oxy)-2-ethyl-2,5,7,12-tetrahydroxy-6,11-dioxo-1,2,3,4,6,11-hexahydrotetracene-1-carboxylate (non-preferred name)
- 1-Naphthacenecarboxylic-acid, 4-(((2''',3''-anhydro)-O-3,6-dideoxy-alpha-L-erythro-hexopyranos-4-ulosyl-(1-4)-O-2,6-dideoxy-alpha-L-lyxo-hexopyranosyl-(1-4)-2,3,6-trideoxy-3-(dimethylamino)-alpha-L-lyxo-hexopyranosyl)oxy)-2-ethyl-1,2,3
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Epelmycin B
CAS:Epelmycin B possesses activity against Gram-positive bacteria, Gram-negative bacteria, and Candida albicans, and also exhibits activity against leukemia L1210.Formula:C42H51NO16Color and Shape:SolidMolecular weight:825.851
