CAS 107811-48-3
:4-methoxy-2-(propan-2-yloxy)benzaldehyde
Description:
4-Methoxy-2-(propan-2-yloxy)benzaldehyde, with the CAS number 107811-48-3, is an organic compound characterized by its aromatic structure, which includes a methoxy group and a propan-2-yloxy substituent attached to a benzaldehyde moiety. This compound typically exhibits a pale yellow to light brown appearance and is soluble in organic solvents such as ethanol and ether, but has limited solubility in water due to its hydrophobic characteristics. The presence of the aldehyde functional group contributes to its reactivity, making it susceptible to oxidation and condensation reactions. Additionally, the methoxy and propan-2-yloxy groups can influence its electronic properties, potentially affecting its reactivity and interaction with other chemical species. This compound may find applications in organic synthesis, particularly in the development of pharmaceuticals or as an intermediate in the production of other chemical entities. Safety data should be consulted for handling and storage, as with any chemical substance.
Formula:C11H14O3
InChI:InChI=1/C11H14O3/c1-8(2)14-11-6-10(13-3)5-4-9(11)7-12/h4-8H,1-3H3
SMILES:CC(C)Oc1cc(ccc1C=O)OC
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
Benzaldehyde, 4-methoxy-2-(1-methylethoxy)-
CAS:Formula:C11H14O3Purity:95%Color and Shape:LiquidMolecular weight:194.22714-Methoxy-2-(propan-2-yloxy)benzaldehyde
CAS:<p>4-Methoxy-2-(propan-2-yloxy)benzaldehyde</p>Purity:95%Molecular weight:194.23g/mol4-Methoxy-2-(propan-2-yloxy)benzaldehyde
CAS:<p>4-Methoxy-2-(propan-2-yloxy)benzaldehyde is a heterobifunctional linker that can be used to connect two molecules. It inhibits the activity of HCT116 cells and has been shown to be an inhibitor of imidazoline receptors. This compound also has the ability to inhibit the E3 ubiquitin ligase and may be useful in cancer therapy.</p>Formula:C11H14O3Purity:Min. 95%Molecular weight:194.23 g/mol
