CymitQuimica logo

CAS 1078162-89-6

:

Pyridinium, 1-(cyanomethyl)-3-[(ethoxycarbonyl)amino]-, chloride (1:1)

Description:
Pyridinium, 1-(cyanomethyl)-3-[(ethoxycarbonyl)amino]-, chloride (1:1) is a chemical compound characterized by its pyridinium structure, which includes a pyridine ring with a cyanomethyl group and an ethoxycarbonylamino substituent. This compound typically exhibits properties associated with both pyridine derivatives and quaternary ammonium salts, such as solubility in polar solvents and potential ionic characteristics due to the presence of the chloride ion. The ethoxycarbonylamino group suggests that it may participate in various chemical reactions, including nucleophilic substitutions and condensation reactions. Additionally, the cyanomethyl group can serve as a versatile functional group in organic synthesis, potentially allowing for further derivatization. The compound's unique structure may impart specific biological activities, making it of interest in medicinal chemistry. However, detailed information regarding its reactivity, stability, and potential applications would require further investigation through experimental studies and literature reviews. As with any chemical substance, proper safety protocols should be followed when handling this compound.
Formula:C10H12N3O2·Cl
InChI:InChI=1S/C10H11N3O2.ClH/c1-2-15-10(14)12-9-4-3-6-13(8-9)7-5-11;/h3-4,6,8H,2,7H2,1H3;1H
InChI key:InChIKey=RZLZIIFWMFCRSR-UHFFFAOYSA-N
SMILES:N(C(OCC)=O)C1=C[N+](CC#N)=CC=C1.[Cl-]
Synonyms:
  • Pyridinium, 1-(cyanomethyl)-3-[(ethoxycarbonyl)amino]-, chloride (1:1)
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.