CymitQuimica logo

CAS 1078162-91-0

:

2-Pyrrolidinecarboxamide, N-(4-bromophenyl)-, hydrochloride (1:1)

Description:
2-Pyrrolidinecarboxamide, N-(4-bromophenyl)-, hydrochloride (1:1) is a chemical compound characterized by its pyrrolidine backbone, which is a five-membered ring containing one nitrogen atom. The presence of the N-(4-bromophenyl) substituent indicates that a bromophenyl group is attached to the nitrogen atom of the pyrrolidine, contributing to its biological activity and potential pharmacological properties. As a hydrochloride salt, it is typically more soluble in water, enhancing its utility in various applications, particularly in pharmaceutical formulations. The compound may exhibit properties such as being a potential inhibitor or modulator in biological systems, making it of interest in medicinal chemistry. Its molecular structure suggests it could interact with specific receptors or enzymes, although detailed biological activity would require further investigation. Safety and handling precautions should be observed, as with any chemical substance, particularly those with halogenated groups, which may pose environmental or health risks.
Formula:C11H13BrN2O·ClH
InChI:InChI=1S/C11H13BrN2O.ClH/c12-8-3-5-9(6-4-8)14-11(15)10-2-1-7-13-10;/h3-6,10,13H,1-2,7H2,(H,14,15);1H
InChI key:InChIKey=JNSCLWAXDFZPDD-UHFFFAOYSA-N
SMILES:C(NC1=CC=C(Br)C=C1)(=O)C2CCCN2.Cl
Synonyms:
  • 2-Pyrrolidinecarboxamide, N-(4-bromophenyl)-, hydrochloride (1:1)
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.