CAS 1078163-19-5

2-Pyrrolidinecarboxamide, N-(5-methyl-2-pyridinyl)-, hydrochloride (1:2)

Description:

2-Pyrrolidinecarboxamide, N-(5-methyl-2-pyridinyl)-, hydrochloride (1:2) is a chemical compound characterized by its pyrrolidine and pyridine moieties, which contribute to its potential biological activity. The presence of the hydrochloride indicates that it is a salt form, enhancing its solubility in water and making it suitable for various applications, particularly in pharmaceutical contexts. This compound may exhibit properties such as being a potential ligand for biological receptors or enzymes, given the structural features of the pyridine ring, which is known for its ability to participate in hydrogen bonding and π-π interactions. The methyl group on the pyridine ring can influence the compound's lipophilicity and overall pharmacokinetic profile. Additionally, the amide functional group suggests potential for hydrogen bonding, which can affect the compound's stability and reactivity. Overall, this compound's unique structural characteristics may render it of interest in medicinal chemistry and drug development, although specific biological activities would require further investigation through empirical studies.

Formula: C₁₁H₁₅N₃O·2ClH

InChI: InChI=1S/C11H15N3O.2ClH/c1-8-4-5-10(13-7-8)14-11(15)9-3-2-6-12-9;;/h4-5,7,9,12H,2-3,6H2,1H3,(H,13,14,15);2*1H

InChI key: InChIKey=RFRZLIRVAINTJF-UHFFFAOYSA-N

SMILES: C(NC1=CC=C(C)C=N1)(=O)C2CCCN2.Cl

Synonyms:

• 2-Pyrrolidinecarboxamide, N-(5-methyl-2-pyridinyl)-, hydrochloride (1:2)