CAS 1078163-21-9

2-Pyrrolidinecarboxamide, N-(2,4-dichlorophenyl)-, hydrochloride (1:1)

Description:

2-Pyrrolidinecarboxamide, N-(2,4-dichlorophenyl)-, hydrochloride (1:1) is a chemical compound characterized by its pyrrolidine backbone, which is a five-membered ring containing nitrogen. The presence of the N-(2,4-dichlorophenyl) group indicates that the compound has a dichlorophenyl substituent, contributing to its potential biological activity. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, which can enhance its bioavailability in pharmaceutical applications. This compound may exhibit properties relevant to medicinal chemistry, particularly in the development of therapeutic agents. Its structure suggests potential interactions with biological targets, making it of interest in drug discovery. The dichlorophenyl moiety may influence its pharmacokinetics and pharmacodynamics, while the pyrrolidine ring can affect its conformational flexibility and binding affinity. Overall, this compound's characteristics make it a subject of interest for further research in various chemical and biological contexts.

Formula: C₁₁H₁₂Cl₂N₂O·ClH

InChI: InChI=1S/C11H12Cl2N2O.ClH/c12-7-3-4-9(8(13)6-7)15-11(16)10-2-1-5-14-10;/h3-4,6,10,14H,1-2,5H2,(H,15,16);1H

InChI key: InChIKey=LWMKTZXOYYBEJO-UHFFFAOYSA-N

SMILES: N(C(=O)C1CCCN1)C2=C(Cl)C=C(Cl)C=C2.Cl

Synonyms:

• 2-Pyrrolidinecarboxamide, N-(2,4-dichlorophenyl)-, hydrochloride (1:1)

N-(2,4-Dichlorophenyl)pyrrolidine-2-carboxamide hydrochloride

CAS: 1078163-21-9

Versatile small molecule scaffold

Formula: C₁₁H₁₃Cl₃N₂O

Purity: Min. 95%

Molecular weight: 295.6 g/mol

Ref: 3D-DTB16321