
CAS 1078163-22-0
:2-Pyrrolidinecarboxamide, N-(3,5-dichlorophenyl)-, hydrochloride (1:1)
Description:
2-Pyrrolidinecarboxamide, N-(3,5-dichlorophenyl)-, hydrochloride (1:1) is a chemical compound characterized by its pyrrolidine backbone, which is a five-membered ring containing nitrogen. The presence of the N-(3,5-dichlorophenyl) group indicates that the compound has a dichlorophenyl substituent, contributing to its potential biological activity and lipophilicity. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, enhancing its utility in pharmaceutical applications. This compound may exhibit properties relevant to medicinal chemistry, particularly in the development of therapeutic agents. Its structure suggests potential interactions with biological targets, making it of interest in drug discovery. Safety and handling precautions should be observed, as with any chemical substance, particularly those with halogenated aromatic groups, which can pose environmental and health risks. Further studies would be necessary to elucidate its specific pharmacological effects and mechanisms of action.
Formula:C11H12Cl2N2O·ClH
InChI:InChI=1S/C11H12Cl2N2O.ClH/c12-7-4-8(13)6-9(5-7)15-11(16)10-2-1-3-14-10;/h4-6,10,14H,1-3H2,(H,15,16);1H
InChI key:InChIKey=YDYPNOVMNGLJGD-UHFFFAOYSA-N
SMILES:C(NC1=CC(Cl)=CC(Cl)=C1)(=O)C2CCCN2.Cl
Synonyms:- 2-Pyrrolidinecarboxamide, N-(3,5-dichlorophenyl)-, hydrochloride (1:1)
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.