CAS 107817-60-7
:tricrozarin A
Description:
Tricrozarin A, with the CAS number 107817-60-7, is a natural product belonging to the class of compounds known as polyketides. It is primarily derived from certain species of fungi, particularly those in the genus Penicillium. This compound is characterized by its complex molecular structure, which typically includes multiple rings and functional groups that contribute to its biological activity. Tricrozarin A has garnered interest in the field of medicinal chemistry due to its potential pharmacological properties, including antimicrobial and cytotoxic activities. Its mechanism of action may involve interference with cellular processes, making it a candidate for further research in drug development. Additionally, the compound's solubility and stability in various solvents can influence its bioavailability and efficacy. As with many natural products, the extraction and purification processes are crucial for obtaining Tricrozarin A in sufficient quantities for study. Overall, Tricrozarin A represents a fascinating area of study within natural product chemistry and its applications in medicine.
Formula:C13H10O8
InChI:InChI=1/C13H10O8/c1-18-10-6(14)4-5(7(15)11(10)19-2)9(17)13-12(8(4)16)20-3-21-13/h16-17H,3H2,1-2H3
Synonyms:- tricrozarin A
- Naphtho[2,3-d]-1,3-dioxole-5,8-dione, 4,9-dihydroxy-6,7-dimethoxy-
- 4,9-Dihydroxy-6,7-dimethoxynaphtho(2,3-d)-1,3-dioxole-5,8-dione
- 5,8-Dihydroxy-2,3-dimethoxy-6,7-methylenedioxy-1,4-naphthoquinone
- 2,3-Dimethoxy-6,7-methylenedioxynaphthazarin
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Tricrozarin A
CAS:Tricrozarin A is a derivative of naphthalene thiazole found in the fresh bulbs of Tritonia crocosmaeflora. It exhibits antibacterial activity against Gram-positive bacteria, fungi, and yeast.Formula:C13H10O8Color and Shape:SolidMolecular weight:294.214
