CymitQuimica logo

CAS 107825-97-8

:

5-Chloro-2-(5-isoxazolyl)phenol

Description:
5-Chloro-2-(5-isoxazolyl)phenol is an organic compound characterized by its phenolic structure, which includes a chlorine substituent and an isoxazole ring. This compound typically exhibits properties associated with both phenols and heterocycles, such as moderate solubility in organic solvents and potential reactivity due to the presence of the hydroxyl group and the chlorine atom. The isoxazole moiety contributes to its biological activity, making it of interest in pharmaceutical research. It may exhibit antimicrobial or antifungal properties, which are common in compounds containing both phenolic and heterocyclic structures. The presence of the chlorine atom can influence its lipophilicity and reactivity, potentially enhancing its biological efficacy. Additionally, the compound's stability and reactivity can be affected by environmental factors such as pH and temperature. Overall, 5-Chloro-2-(5-isoxazolyl)phenol is a compound of interest in medicinal chemistry, with potential applications in drug development and agrochemicals.
Formula:C9H6ClNO2
InChI:InChI=1S/C9H6ClNO2/c10-6-1-2-7(8(12)5-6)9-3-4-11-13-9/h1-5,12H
InChI key:InChIKey=QOAUHUZBNWNKBU-UHFFFAOYSA-N
SMILES:OC1=C(C2=CC=NO2)C=CC(Cl)=C1
Synonyms:
  • 5-Chloro-2-(5-isoxazolyl)phenol
  • Phenol, 5-chloro-2-(5-isoxazolyl)-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.