CAS 107833-98-7
:2-[(1-oxidopyridin-1-ium-3-carbonyl)amino]ethyl nitrate
Description:
2-[(1-Oxidopyridin-1-ium-3-carbonyl)amino]ethyl nitrate, with the CAS number 107833-98-7, is a chemical compound characterized by its complex structure that includes a pyridine ring, a carbonyl group, and a nitrate functional group. This compound typically exhibits properties associated with both organic nitrates and heterocyclic compounds. It is likely to be a polar substance due to the presence of the nitrate group and the charged pyridinium moiety, which can influence its solubility in polar solvents. The presence of the carbonyl group suggests potential reactivity, particularly in nucleophilic addition reactions. Additionally, the compound may exhibit biological activity, as many derivatives of pyridine and nitrates are known for their pharmacological properties. Its stability, reactivity, and potential applications would depend on the specific conditions and the presence of other reagents. As with many chemical substances, safety data and handling precautions should be consulted before use, given the potential for toxicity or reactivity.
Formula:C8H9N3O5
InChI:InChI=1/C8H9N3O5/c12-8(9-3-5-16-11(14)15)7-2-1-4-10(13)6-7/h1-2,4,6H,3,5H2,(H,9,12)
SMILES:c1cc(cn(=O)c1)C(=NCCON(=O)=O)O
Synonyms:- Nicorandil Impurity 11
- 3-((2-(nitrooxy)ethyl)carbamoyl)pyridine 1-oxide
- Nicorandil N-Oxide
- 2-[(1-oxidopyridin-1-ium-3-carbonyl)amino]ethyl nitrate
- Nicorandil Pyridine Oxide
- 3-Pyridinecarboxamide, N-[2-(nitrooxy)ethyl]-, 1-oxide
- Nicorandil N-oxide Q: What is the storage condition of
- Nicorandil N-oxide
- Nicorandil N-oxideQ: What is
- Nicorandil N-oxide Q: What is the CAS Number of
- N-[2-(Nitrooxy)ethyl]-3-pyridinecarboxaMide 1-Oxide
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 4 products.
Nicorandil Pyridine N-Oxide
CAS:Formula:C8H9N3O5Color and Shape:Pale Yellow SolidMolecular weight:227.18Nicorandil N-Oxide
CAS:Controlled Product<p>Applications A Nicorandil (N398500) derivative<br></p>Formula:C8H9N3O5Color and Shape:NeatMolecular weight:227.17Nicorandil N-oxide
CAS:Nicorandil N-oxide, a metabolite of nicorandil, functions as an activator of the ATP-sensitive potassium channel Kir6.2 (SUR2B/Kir6.2) and is associated with the sulfonylurea receptor 2B (SUR2B), while also serving as a nitric oxide donor.Formula:C8H9N3O5Color and Shape:SolidMolecular weight:227.17



