CAS 107843-77-6
:benzyl (2E)-3-(3,4-dihydroxyphenyl)prop-2-enoate
Description:
Benzyl (2E)-3-(3,4-dihydroxyphenyl)prop-2-enoate, with the CAS number 107843-77-6, is an organic compound characterized by its ester functional group and a phenolic structure. It features a benzyl group attached to a prop-2-enoate moiety, which includes a double bond and a side chain containing a 3,4-dihydroxyphenyl group. This compound is typically a white to pale yellow solid and is soluble in organic solvents such as ethanol and acetone, but may have limited solubility in water due to its hydrophobic benzyl and phenolic components. The presence of hydroxyl groups contributes to its potential antioxidant properties, making it of interest in various biological and pharmaceutical applications. Additionally, the conjugated double bond in the prop-2-enoate structure may impart some degree of reactivity, allowing for further chemical modifications. Overall, this compound is notable for its structural features that combine aromaticity with functional groups that can participate in various chemical interactions.
Formula:C16H14O4
InChI:InChI=1/C16H14O4/c17-14-8-6-12(10-15(14)18)7-9-16(19)20-11-13-4-2-1-3-5-13/h1-10,17-18H,11H2/b9-7+
Synonyms:- 2-Propenoic acid, 3-(3,4-dihydroxyphenyl)-, phenylmethyl ester
- 2-propenoic acid, 3-(3,4-dihydroxyphenyl)-, phenylmethyl ester, (2E)-
- Benzyl (2E)-3-(3,4-dihydroxyphenyl)acrylate
- Benzyl 3,4-dihydroxycinnamate
- Phenylmethyl 3-(3,4-dihydroxyphenyl)-2-Propenoate
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
Caffeic Acid Benzyl Ester
CAS:Controlled ProductApplications Caffeic Acid analog potentially having anti-inflammatory effects.
References Gardana, C., et al.: J. Pharm. Biomed. Anal., 45, 390 (2007), Falcao, S., et al.: Anal. Bioanal. Chem., 396, 887 (2010),Formula:C16H14O4Color and Shape:Light YellowMolecular weight:270.28Caffeic acid benzyl ester
CAS:Caffeic acid benzyl ester is a derivative of caffeic acid, naturally found in propolis. Caffeic acid benzyl ester has strong antioxidant activity and is one of the components responsible for the antimicrobial activity of propolis. Propolis extract containing caffeic acid benzyl ester has been investigated as alternative food preservative.Formula:C16H14O4Purity:Min. 95%Molecular weight:270.28 g/mol



