CAS 1078603-66-3

L-Cysteine, S-[2-(4-bromophenyl)-2-oxoethyl]-, ethyl ester, 2,2,2-trifluoroacetate (1:1)

Description:

L-Cysteine, S-[2-(4-bromophenyl)-2-oxoethyl]-, ethyl ester, 2,2,2-trifluoroacetate (1:1) is a synthetic compound that features a cysteine backbone modified with a bromophenyl group and an ethyl ester functionality. This compound is characterized by its unique structural components, which include a thiol group (-SH) from the cysteine, contributing to its reactivity and potential biological activity. The presence of the 4-bromophenyl moiety may enhance lipophilicity and influence the compound's interaction with biological targets. The trifluoroacetate group can impart stability and solubility in various solvents, making it suitable for diverse applications in medicinal chemistry and biochemistry. Additionally, the compound's ester functionality suggests potential for hydrolysis, which could release the active cysteine moiety under physiological conditions. Overall, this compound may exhibit interesting pharmacological properties, warranting further investigation into its biological effects and potential therapeutic applications.

Formula: C₁₃H₁₆BrNO₃S·C₂HF₃O₂

InChI: InChI=1S/C13H16BrNO3S.C2HF3O2/c1-2-18-13(17)11(15)7-19-8-12(16)9-3-5-10(14)6-4-9;3-2(4,5)1(6)7/h3-6,11H,2,7-8,15H2,1H3;(H,6,7)/t11-;/m0./s1

InChI key: InChIKey=ZCALCLGCJLCACW-MERQFXBCSA-N

SMILES: C(CSC[C@@H](C(OCC)=O)N)(=O)C1=CC=C(Br)C=C1.C(C(O)=O)(F)(F)F

Synonyms:

• L-Cysteine, S-[2-(4-bromophenyl)-2-oxoethyl]-, ethyl ester, 2,2,2-trifluoroacetate (1:1)