
CAS 1078610-94-2
:Benzenemethanamine, 2,3,4,6-tetrafluoro-, hydrochloride (1:1)
Description:
Benzenemethanamine, 2,3,4,6-tetrafluoro-, hydrochloride (1:1), commonly referred to as a tetrafluorinated derivative of benzenemethanamine, is characterized by the presence of four fluorine atoms substituted on the benzene ring, which significantly influences its chemical properties. The fluorination enhances the compound's lipophilicity and stability, making it potentially useful in various applications, including pharmaceuticals and agrochemicals. As a hydrochloride salt, it exists as a stable, water-soluble form, facilitating its handling and use in aqueous environments. The presence of the amine functional group suggests basic properties, allowing it to participate in various chemical reactions, including nucleophilic substitutions and coupling reactions. Additionally, the compound's structure may impart unique biological activities, making it of interest in medicinal chemistry. Its specific interactions and reactivity can be influenced by the electron-withdrawing nature of the fluorine atoms, which can affect the compound's overall reactivity and interaction with biological targets. Safety and handling precautions should be observed due to the potential toxicity associated with fluorinated compounds.
Formula:C7H6ClF4N
InChI:InChI=1S/C7H5F4N.ClH/c8-4-1-5(9)7(11)6(10)3(4)2-12;/h1H,2,12H2;1H
InChI key:InChIKey=RKRRFXPJXNNWGE-UHFFFAOYSA-N
SMILES:C(N)C1=C(F)C(F)=C(F)C=C1F.Cl
Synonyms:- Benzenemethanamine, 2,3,4,6-tetrafluoro-, hydrochloride (1:1)
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 2 products.
2,3,4,6-Tetrafluorobenzylamine hydrochloride
CAS:2,3,4,6-Tetrafluorobenzylamine hydrochloridePurity:≥95%Molecular weight:215.58g/mol2,3,4,6-Tetrafluorobenzylamine hydrochloride
CAS:2,3,4,6-Tetrafluorobenzylamine hydrochloride is a fluorescent organic dye that binds to the antibody and can be used as a research tool for studying protein interactions. 2,3,4,6-Tetrafluorobenzylamine hydrochloride is also an inhibitor of the ion channel TRPV1. This compound has been shown to be a ligand and activator of nicotinic acetylcholine receptors. It binds to the receptor with high affinity and is an excellent fluorescent probe for covalent labeling of peptides and proteins.
Formula:C7H6ClF4NPurity:Min. 95%Molecular weight:215.57 g/mol

