CymitQuimica logo

CAS 1078627-84-5

:

2,3-Dimethoxybenzenemethanesulfonamide

Description:
2,3-Dimethoxybenzenemethanesulfonamide is an organic compound characterized by its sulfonamide functional group attached to a methoxy-substituted benzene ring. The presence of two methoxy groups at the 2 and 3 positions of the benzene ring enhances its solubility in polar solvents and may influence its reactivity and biological activity. This compound typically exhibits moderate to high stability under standard conditions, although it may be sensitive to strong acids or bases. The sulfonamide group is known for its antibacterial properties, making compounds of this class of interest in medicinal chemistry. Additionally, the molecular structure suggests potential for hydrogen bonding due to the sulfonamide nitrogen, which can affect its interactions with biological targets. The compound's physical properties, such as melting point and solubility, would depend on its specific molecular interactions and the presence of functional groups. Overall, 2,3-Dimethoxybenzenemethanesulfonamide represents a versatile structure with potential applications in pharmaceuticals and chemical research.
Formula:C9H13NO4S
InChI:InChI=1S/C9H13NO4S/c1-13-8-5-3-4-7(9(8)14-2)6-15(10,11)12/h3-5H,6H2,1-2H3,(H2,10,11,12)
InChI key:InChIKey=SGVUAOZPJGTLDX-UHFFFAOYSA-N
SMILES:C(S(N)(=O)=O)C1=C(OC)C(OC)=CC=C1
Synonyms:
  • (2,3-Dimethoxyphenyl)methanesulfonamide
  • Benzenemethanesulfonamide, 2,3-dimethoxy-
  • 2,3-Dimethoxybenzenemethanesulfonamide
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.