CAS 107868-36-0: Androsta-1,4-diene-3,17-dione, 4-chloro-6-methylene-

Description:Androsta-1,4-diene-3,17-dione, 4-chloro-6-methylene- is a synthetic steroid compound that belongs to the class of androgens and anabolic steroids. It is characterized by its structural modifications, which include a diene system and a chlorine substituent, contributing to its unique biological activity. The compound typically exhibits properties associated with steroid hormones, such as the ability to bind to androgen receptors, influencing various physiological processes, including muscle growth and development. Its chemical structure includes a steroid backbone with specific functional groups that enhance its potency and selectivity. The presence of the 4-chloro and 6-methylene groups can affect its metabolic stability and bioavailability. This compound is often studied for its potential applications in sports medicine and bodybuilding, although it may also be subject to regulatory scrutiny due to its anabolic properties. As with many synthetic steroids, safety and efficacy are critical considerations in its use, and further research is necessary to fully understand its pharmacological profile and potential side effects.

Formula:C₂₀H₂₃ClO₂

InChI:InChI=1S/C20H23ClO2/c1-11-10-12-13-4-5-16(23)19(13,2)8-6-14(12)20(3)9-7-15(22)18(21)17(11)20/h7,9,12-14H,1,4-6,8,10H2,2-3H3/t12-,13-,14-,19-,20+/m0/s1

InChI key:InChIKey=UGMALTYFJCIPHD-RDVHEEPHSA-N

SMILES:O=C1C=CC2(C(=C1Cl)C(=C)CC3C2CCC4(C(=O)CCC34)C)C