CAS 107873-03-0
:2,2-Difluorocyclopropanecarboxylic acid
Description:
2,2-Difluorocyclopropanecarboxylic acid is a fluorinated organic compound characterized by its cyclopropane ring structure, which is substituted with two fluorine atoms and a carboxylic acid functional group. This compound typically exhibits a high degree of reactivity due to the presence of the carboxylic acid group, which can participate in various chemical reactions, including esterification and acid-base reactions. The fluorine atoms contribute to the compound's unique properties, such as increased lipophilicity and potential biological activity, making it of interest in medicinal chemistry and agrochemical applications. Additionally, the presence of the cyclopropane ring can impart strain, influencing the compound's stability and reactivity. Its physical properties, such as boiling point and solubility, are influenced by the functional groups and the overall molecular structure. As with many fluorinated compounds, 2,2-difluorocyclopropanecarboxylic acid may exhibit distinct environmental and toxicological profiles, necessitating careful handling and assessment in research and industrial contexts.
Formula:C4H4F2O2
InChI:InChI=1/C4H4F2O2/c5-4(6)1-2(4)3(7)8/h2H,1H2,(H,7,8)
SMILES:C1C(C(=O)O)C1(F)F
Synonyms:- Cyclopropanecarboxylic acid, 2,2-difluoro-
- 4,4,4-Trifluoro-3-Hydroxybutanoic Acid
- 2,2-Difluorocyclopropane-1-carboxylic acid
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
2,2-Difluorocyclopropanecarboxylic Acid
CAS:Formula:C4H4F2O2Purity:>98.0%(GC)(T)Color and Shape:White to Light yellow powder to crystalMolecular weight:122.072,2-Difluorocyclopropanecarboxylic acid, 95%
CAS:2,2-Difluorocyclopropanecarboxylic acid derivative (i.e. 2,2-difluorocyclopropanecarbonyl chloride) is used in Friedel-Crafts reactions with various arenes to prepare aryl 2,2-difluorocyclopropyl ketones. This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product po
Formula:C4H4F2O2Purity:95%Color and Shape:White to very pale brown, Crystals or powder or crystalline powderMolecular weight:122.072,2-Difluorocyclopropanecarboxylic acid
CAS:Formula:C4H4F2O2Purity:97%Color and Shape:SolidMolecular weight:122.07022,2-Difluorocyclopropane-1-carboxylic acid
CAS:2,2-Difluorocyclopropane-1-carboxylic acidFormula:C4H4F2O2Purity:98%Color and Shape: white to off white crystalline powderMolecular weight:122.07g/mol2,2-Difluorocyclopropanecarboxylic acid
CAS:Formula:C4H4F2O2Purity:95%Color and Shape:SolidMolecular weight:122.071




