CymitQuimica logo

CAS 107873-03-0

:

2,2-Difluorocyclopropanecarboxylic acid

Description:
2,2-Difluorocyclopropanecarboxylic acid is a fluorinated organic compound characterized by its cyclopropane ring structure, which is substituted with two fluorine atoms and a carboxylic acid functional group. This compound typically exhibits a high degree of reactivity due to the presence of the carboxylic acid group, which can participate in various chemical reactions, including esterification and acid-base reactions. The fluorine atoms contribute to the compound's unique properties, such as increased lipophilicity and potential biological activity, making it of interest in medicinal chemistry and agrochemical applications. Additionally, the presence of the cyclopropane ring can impart strain, influencing the compound's stability and reactivity. Its physical properties, such as boiling point and solubility, are influenced by the functional groups and the overall molecular structure. As with many fluorinated compounds, 2,2-difluorocyclopropanecarboxylic acid may exhibit distinct environmental and toxicological profiles, necessitating careful handling and assessment in research and industrial contexts.
Formula:C4H4F2O2
InChI:InChI=1/C4H4F2O2/c5-4(6)1-2(4)3(7)8/h2H,1H2,(H,7,8)
InChI key:KMLMOVWSQPHQME-UHFFFAOYSA-N
SMILES:C1C(C(=O)O)C1(F)F
Synonyms:
  • Cyclopropanecarboxylic acid, 2,2-difluoro-
  • 4,4,4-Trifluoro-3-Hydroxybutanoic Acid
  • 2,2-Difluorocyclopropane-1-carboxylic acid
Found 6 products.