CAS 107879-46-9

N2-Methyl-1H-benzimidazole-1,2-diamine

Description:

N2-Methyl-1H-benzimidazole-1,2-diamine, with the CAS number 107879-46-9, is a chemical compound characterized by its benzimidazole core structure, which features a fused benzene and imidazole ring. This compound typically exhibits properties associated with amines and heterocycles, including potential basicity due to the presence of amino groups. It is often studied for its biological activity, particularly in the context of medicinal chemistry, where it may exhibit properties such as antitumor or antimicrobial effects. The methyl group at the N2 position can influence its solubility and reactivity. In terms of physical properties, it may be a solid at room temperature, with varying solubility in polar and non-polar solvents depending on the specific functional groups present. Safety data should be consulted for handling, as compounds with amine functionalities can be hazardous. Overall, N2-Methyl-1H-benzimidazole-1,2-diamine is of interest in both synthetic and pharmaceutical chemistry due to its unique structural features and potential applications.

Formula: C₈H₁₀N₄

InChI: InChI=1S/C8H10N4/c1-10-8-11-6-4-2-3-5-7(6)12(8)9/h2-5H,9H2,1H3,(H,10,11)

InChI key: InChIKey=SXJOIEGSRDDFQM-UHFFFAOYSA-N

SMILES: NN1C=2C(N=C1NC)=CC=CC2

Synonyms:

• 1H-Benzimidazole-1,2-diamine, N2-methyl-
• 1-Amino-2-(methylamino)benzimidazole
• N2-Methyl-1H-benzimidazole-1,2-diamine