CymitQuimica logo

CAS 1078791-16-8

:

N-(4-Bromophenyl)-2-pyrrolidinecarboxamide

Description:
N-(4-Bromophenyl)-2-pyrrolidinecarboxamide is a chemical compound characterized by its unique structure, which includes a pyrrolidine ring and a bromophenyl group. This compound features a carboxamide functional group, which contributes to its potential as a bioactive molecule. The presence of the bromine atom on the phenyl ring can influence its reactivity and biological activity, often enhancing lipophilicity and modulating interactions with biological targets. The molecular structure suggests that it may exhibit properties relevant to medicinal chemistry, potentially serving as a lead compound in drug development. Its solubility, stability, and reactivity can vary based on environmental conditions and the presence of other functional groups. As with many organic compounds, safety and handling precautions are essential, particularly due to the presence of the bromine atom, which can pose health risks. Overall, N-(4-Bromophenyl)-2-pyrrolidinecarboxamide represents a compound of interest in various fields, including pharmaceuticals and materials science.
Formula:C11H13BrN2O
InChI:InChI=1S/C11H13BrN2O/c12-8-3-5-9(6-4-8)14-11(15)10-2-1-7-13-10/h3-6,10,13H,1-2,7H2,(H,14,15)
InChI key:InChIKey=JFKUAGJYOKMVRW-UHFFFAOYSA-N
SMILES:C(NC1=CC=C(Br)C=C1)(=O)C2CCCN2
Synonyms:
  • N-(4-Bromophenyl)-2-pyrrolidinecarboxamide
  • 2-Pyrrolidinecarboxamide, N-(4-bromophenyl)-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.