CAS 107889-32-7

(5Z)-5-[(3,5-di-tert-butyl-4-hydroxyphenyl)methylidene]-1,3-thiazolidin-4-one

Description:

The chemical substance known as (5Z)-5-[(3,5-di-tert-butyl-4-hydroxyphenyl)methylidene]-1,3-thiazolidin-4-one, with the CAS number 107889-32-7, is a thiazolidinone derivative characterized by its unique structural features, including a thiazolidine ring and a substituted phenolic group. This compound exhibits antioxidant properties, largely attributed to the presence of the di-tert-butylhydroxyphenyl moiety, which can scavenge free radicals and inhibit oxidative stress. The thiazolidinone core contributes to its potential biological activity, making it of interest in medicinal chemistry and materials science. Additionally, the bulky tert-butyl groups enhance its lipophilicity, which may influence its solubility and bioavailability. The compound's stability and reactivity can be affected by environmental factors such as pH and temperature, making it important to consider these conditions in practical applications. Overall, this substance is notable for its potential applications in pharmaceuticals and as an antioxidant agent in various formulations.

Formula: C₁₈H₂₅NO₂S

InChI: InChI=1/C18H25NO2S/c1-17(2,3)12-7-11(9-14-16(21)19-10-22-14)8-13(15(12)20)18(4,5)6/h7-9,20H,10H2,1-6H3,(H,19,21)/b14-9-

SMILES: CC(C)(C)c1cc(cc(c1O)C(C)(C)C)/C=C\1/C(=NCS1)O

LY 178002

CAS: 107889-32-7

LY 178002 inhibits 5-LPO (IC50: 0.6 μM), PLA2, and LTB4 production; weak on cyclooxygenase.

Formula: C₁₈H₂₅NO₂S

Purity: 98%

Color and Shape: Solid

Molecular weight: 319.46

Ref: TM-T15825