CAS 1079-02-3
:Benzoic-2,3,4,5,6-d5 acid
Description:
Benzoic-2,3,4,5,6-d5 acid, also known as deuterated benzoic acid, is a deuterated form of benzoic acid where five hydrogen atoms are replaced by deuterium, a stable isotope of hydrogen. This substitution alters the physical and chemical properties of the compound, making it useful in various applications, particularly in NMR spectroscopy, where the presence of deuterium helps in distinguishing signals and improving resolution. The compound retains the characteristic carboxylic acid functional group (-COOH), which contributes to its acidity and solubility in polar solvents. Benzoic-2,3,4,5,6-d5 acid is typically a white crystalline solid at room temperature and exhibits similar reactivity to non-deuterated benzoic acid, participating in typical acid-base reactions and forming salts with bases. Its unique isotopic composition allows for studies in reaction mechanisms and kinetics, as well as in tracing pathways in metabolic studies. The CAS number 1079-02-3 uniquely identifies this compound in chemical databases, facilitating its use in research and industrial applications.
Formula:C7HD5O2
InChI:InChI=1S/C7H6O2/c8-7(9)6-4-2-1-3-5-6/h1-5H,(H,8,9)/i1D,2D,3D,4D,5D
InChI key:InChIKey=WPYMKLBDIGXBTP-RALIUCGRSA-N
SMILES:C(O)(=O)C1=C(C(=C(C(=C1[2H])[2H])[2H])[2H])[2H]
Synonyms:- Benzoic-2,3,4,5,6-d5 acid
- 2,3,4,5,6-Pentadeuteriobenzoic acid
- Benzoic-d5 acid
- Benzoic acid-d5
- Pentadeuteriobenzoic acid
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 7 products.
Benzoic-d5 Acid(non marqué 65-85-0)
CAS:Formula:C6D5COOHPurity:99 atom % DColor and Shape:White SolidMolecular weight:127.06816Benzoic acid D5 (phenyl D5)
CAS:Controlled ProductFormula:C7H5HO2Color and Shape:NeatMolecular weight:127.15Benzoic Acid-d5
CAS:Controlled Product<p>Applications Benzoic Acid-d5 is a compound useful in organic synthesis. A pentadeuterated form of benzoic acid for proteomics research.<br>References Kurogochi, M., et al.: Molecules, 19, 9944 (2014); Liang, X., et al.: Asian J. Org. Chem., 6, 1063 (2017)<br></p>Formula:C72H5HO2Color and Shape:NeatMolecular weight:127.15Benzoic- d5- acid
CAS:Controlled ProductBenzoic acid is a carboxylic acid that is found naturally in many plants, fruits and vegetables. It has been shown to be an effective inhibitor of bacterial growth by binding to the glycan moiety of peptidoglycans. Benzoic acid can be used as a calibrant for mass spectrometry. The molecular weight of benzoic acid is 100.06 g/mol and its melting point is 152 °C (309 °F). Benzoic acid has two structural isomers: ortho-benzoic acid and meta-benzoic acid. Ortho-benzoic acid has a molecular weight of 102.09 g/mol and a melting point of 145 °C (293 °F). Meta-benzoic acid has a molecular weight of 104.10 g/mol and a melting point of 155 °C (311 °F). Benzoate may also be produced from the reaction between benzoyl chloride with sodium benzoFormula:C7HD5O2Purity:Min. 95%Molecular weight:127.15 g/mol







