CymitQuimica logo

CAS 1079-65-8

:

diphenylphosphinous bromide

Description:
Diphenylphosphinous bromide, with the CAS number 1079-65-8, is an organophosphorus compound characterized by the presence of a phosphorus atom bonded to two phenyl groups and a bromine atom. It typically appears as a colorless to pale yellow liquid or solid, depending on its physical state at room temperature. This compound is known for its reactivity, particularly in nucleophilic substitution reactions, due to the presence of the phosphorus-bromine bond. Diphenylphosphinous bromide can act as a phosphine precursor and is often utilized in organic synthesis, particularly in the preparation of phosphine oxides and other phosphorus-containing compounds. Its properties include moderate solubility in organic solvents and potential toxicity, necessitating careful handling and storage. Additionally, it may exhibit some degree of stability under ambient conditions but can decompose or react under certain circumstances, especially when exposed to moisture or strong nucleophiles. As with many organophosphorus compounds, it is essential to consider safety protocols when working with diphenylphosphinous bromide due to its chemical reactivity and potential hazards.
Formula:C12H10BrP
InChI:InChI=1/C12H10BrP/c13-14(11-7-3-1-4-8-11)12-9-5-2-6-10-12/h1-10H
Synonyms:
  • Phosphinous bromide, diphenyl-
  • Bromodiphenylphosphine
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.