
CAS 107900-79-8
:Lucidumol B
Description:
Lucidumol B, with the CAS number 107900-79-8, is a chemical compound that has garnered interest primarily due to its presence in certain medicinal mushrooms, particularly Ganoderma lucidum, commonly known as reishi. This compound is classified as a triterpenoid, which is a type of chemical structure known for its diverse biological activities. Lucidumol B is recognized for its potential pharmacological properties, including anti-inflammatory, antioxidant, and immunomodulatory effects. Research suggests that it may play a role in promoting health by modulating various biochemical pathways, although further studies are necessary to fully elucidate its mechanisms of action and therapeutic potential. Additionally, Lucidumol B's solubility and stability in different solvents can influence its bioavailability and efficacy in biological systems. As with many natural compounds, its safety profile and potential side effects are important considerations for therapeutic applications, necessitating thorough investigation in clinical settings.
Formula:C30H50O3
InChI:InChI=1S/C30H50O3/c1-19(9-12-25(32)27(4,5)33)20-13-17-30(8)22-10-11-23-26(2,3)24(31)15-16-28(23,6)21(22)14-18-29(20,30)7/h10,14,19-20,23-25,31-33H,9,11-13,15-18H2,1-8H3/t19-,20-,23+,24+,25+,28-,29-,30+/m1/s1
InChI key:InChIKey=BLTRPNNWBNKAEH-LCWRUPSGSA-N
SMILES:C[C@@]12C=3C([C@@]4(C)[C@](C)(CC3)[C@@]([C@@H](CC[C@@H](C(C)(C)O)O)C)(CC4)[H])=CC[C@]1(C(C)(C)[C@@H](O)CC2)[H]
Synonyms:- Lucidumol B
- (3β,24S)-Lanosta-7,9(11)-diene-3,24,25-triol
- Lanosta-7,9(11)-diene-3,24,25-triol, (3β,24S)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Lanost-7,9(11)-diene-3,24,25-triol-, (3β,24S)-
CAS:Lanost-7,9(11)-diene-3,24,25-triol-, (3beta,24S)- is a bioactive chemical.Formula:C30H50O3Color and Shape:SolidMolecular weight:458.72
