
CAS 107904-08-5
:Ethyl 4-(phenylmethyl)-2-morpholinecarboxylate
Description:
Ethyl 4-(phenylmethyl)-2-morpholinecarboxylate, identified by its CAS number 107904-08-5, is an organic compound that belongs to the class of morpholine derivatives. This substance features a morpholine ring, which is a six-membered heterocyclic structure containing one nitrogen atom and five carbon atoms. The compound is characterized by the presence of an ethyl ester functional group and a phenylmethyl substituent, which contribute to its chemical properties and potential biological activity. Ethyl 4-(phenylmethyl)-2-morpholinecarboxylate is typically a colorless to pale yellow liquid or solid, depending on its purity and specific conditions. It is soluble in organic solvents, which makes it useful in various chemical applications, including as an intermediate in organic synthesis. The compound may exhibit interesting pharmacological properties, although specific biological activities would require further investigation. Safety data should be consulted for handling and usage, as with any chemical substance, to ensure proper precautions are taken.
Formula:C14H19NO3
InChI:InChI=1S/C14H19NO3/c1-2-17-14(16)13-11-15(8-9-18-13)10-12-6-4-3-5-7-12/h3-7,13H,2,8-11H2,1H3
InChI key:InChIKey=JDVADOGJQJZIOJ-UHFFFAOYSA-N
SMILES:C(N1CC(C(OCC)=O)OCC1)C2=CC=CC=C2
Synonyms:- 4-Phenylmethyl-2-morpholinecarboxylic acid ethyl ester
- 2-Morpholinecarboxylic acid, 4-(phenylmethyl)-, ethyl ester
- Ethyl 4-(phenylmethyl)-2-morpholinecarboxylate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.