CAS 107910-75-8: Ganciclovir sodium
Description:Ganciclovir sodium is an antiviral medication primarily used to treat cytomegalovirus (CMV) infections, particularly in immunocompromised patients, such as those with HIV/AIDS or organ transplant recipients. It is a sodium salt form of ganciclovir, which is a synthetic analogue of guanosine. The compound exhibits characteristics such as being a white to off-white crystalline powder, soluble in water, and having a relatively high melting point. Ganciclovir sodium works by inhibiting viral DNA synthesis, thereby preventing the replication of the virus. Its mechanism of action involves selective phosphorylation by viral kinases, leading to the incorporation of the drug into viral DNA, which ultimately disrupts viral replication. The substance is typically administered intravenously or orally, depending on the clinical scenario. Due to its potential side effects, including bone marrow suppression and nephrotoxicity, careful monitoring is required during treatment. Additionally, it is classified as a hazardous substance, necessitating appropriate handling and disposal procedures in clinical settings.
Formula:C9H13N5O4·Na
InChI:InChI=1S/C9H13N5O4.Na/c10-9-12-7-6(8(17)13-9)11-3-14(7)4-18-5(1-15)2-16;/h3,5,15-16H,1-2,4H2,(H3,10,12,13,17);
InChI key:InChIKey=CYNKKJBOBVXOGX-UHFFFAOYSA-N
SMILES:[Na].O=C1N=C(N)NC2=C1N=CN2COC(CO)CO
- Synonyms:
- 2-Amino-1,9-Dihydro-9-[[2-Hydroxy-1-(Hydroxymethyl)Ethoxy]Methyl]-6H-Purin-6-One Sodium Salt
- 2-amino-9-{[(1,3-dihydroxypropan-2-yl)oxy]methyl}-3,9-dihydro-6H-purin-6-one
- 6H-Purin-6-one, 2-amino-1,9-dihydro-9-[[2-hydroxy-1-(hydroxymethyl)ethoxy]methyl]-, monosodium salt
- 6H-Purin-6-one, 2-amino-1,9-dihydro-9-[[2-hydroxy-1-(hydroxymethyl)ethoxy]methyl]-, sodium salt (1:1)
- Cymevene
- Cytovene
- Cytovene IV
- RS 21592 sodium
- sodium 2-amino-9-{[(1,3-dihydroxypropan-2-yl)oxy]methyl}-6,9-dihydro-3H-purin-6-olate
- Ganciclovir sodium
- See more synonyms
