
CAS 1079178-93-0
:N-Cyclopropyl-4-methoxy-2,5-dimethylbenzenemethanamine
Description:
N-Cyclopropyl-4-methoxy-2,5-dimethylbenzenemethanamine, with the CAS number 1079178-93-0, is a chemical compound characterized by its complex structure, which includes a cyclopropyl group, a methoxy group, and a dimethyl-substituted benzene ring. This compound is classified as an aromatic amine due to the presence of an amine functional group attached to a benzene derivative. The cyclopropyl group contributes to its unique steric and electronic properties, potentially influencing its reactivity and interaction with biological targets. The methoxy group can enhance solubility and affect the compound's overall polarity. Additionally, the presence of multiple methyl groups on the benzene ring may impact its stability and reactivity. Such compounds are often studied for their potential applications in pharmaceuticals, particularly in the development of new therapeutic agents. However, specific properties such as melting point, boiling point, and solubility would require empirical data for precise characterization.
Formula:C13H19NO
InChI:InChI=1S/C13H19NO/c1-9-7-13(15-3)10(2)6-11(9)8-14-12-4-5-12/h6-7,12,14H,4-5,8H2,1-3H3
InChI key:InChIKey=GTBGNNIVTMGGLC-UHFFFAOYSA-N
SMILES:C(NC1CC1)C2=C(C)C=C(OC)C(C)=C2
Synonyms:- Benzenemethanamine, N-cyclopropyl-4-methoxy-2,5-dimethyl-
- N-Cyclopropyl-4-methoxy-2,5-dimethylbenzenemethanamine
- (2,5-Dimethyl-4-methoxybenzyl)cyclopropyl amine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.