CAS 107922-87-2

(2-CHLORO-BENZYL)-(3-MORPHOLIN-4-YL-PROPYL)-AMINE

Description:

(2-Chloro-benzyl)-(3-morpholin-4-yl-propyl)-amine, with the CAS number 107922-87-2, is a chemical compound characterized by its structural components, which include a benzyl group substituted with a chlorine atom and a propyl chain linked to a morpholine ring. This compound typically exhibits properties associated with amines, such as basicity and the ability to form hydrogen bonds due to the presence of the amine functional group. The morpholine moiety contributes to its potential solubility in polar solvents and may influence its biological activity. The chlorine substituent on the benzyl ring can affect the compound's reactivity and interaction with biological targets. Such compounds are often studied for their pharmacological properties, including potential applications in medicinal chemistry. Overall, the unique combination of functional groups in this molecule suggests it may possess interesting chemical reactivity and biological activity, making it a subject of interest in various fields, including drug development and synthetic chemistry.

Formula: C₁₄H₂₃ClN₂O

InChI: InChI=1/C14H21ClN2O/c15-14-5-2-1-4-13(14)12-16-6-3-7-17-8-10-18-11-9-17/h1-2,4-5,16H,3,6-12H2/p+2

Synonyms:

• ZERENEX E/6027597
• N-(2-CHLOROBENZYL)-3-MORPHOLIN-4-YLPROPAN-1-AMINE
• 4-{3-[(2-chlorobenzyl)ammonio]propyl}morpholin-4-ium