CAS 107932-98-9

Ethyl 3H-imidazo[4,5-b]pyridine-2-acetate

Description:

Ethyl 3H-imidazo[4,5-b]pyridine-2-acetate is a chemical compound characterized by its unique bicyclic structure, which incorporates both imidazole and pyridine rings. This compound typically appears as a solid or crystalline substance and is soluble in organic solvents, reflecting its moderate polarity. The presence of the ethyl acetate moiety contributes to its reactivity and potential applications in organic synthesis and medicinal chemistry. Ethyl 3H-imidazo[4,5-b]pyridine-2-acetate may exhibit biological activity, making it of interest in pharmacological research, particularly in the development of new therapeutic agents. Its molecular structure allows for various functional group modifications, which can enhance its biological properties or alter its solubility and stability. As with many chemical substances, safety data should be consulted to understand its handling, storage, and potential hazards. Overall, this compound represents a versatile scaffold for further chemical exploration and application in various fields of research.

Formula: C₁₀H₁₁N₃O₂

InChI: InChI=1S/C10H11N3O2/c1-2-15-9(14)6-8-12-7-4-3-5-11-10(7)13-8/h3-5H,2,6H2,1H3,(H,11,12,13)

InChI key: InChIKey=MBJLVQKGFDSQGA-UHFFFAOYSA-N

SMILES: C(C(OCC)=O)C=1NC=2C(N1)=NC=CC2

Synonyms:

• 3H-Imidazo[4,5-b]pyridine-2-acetic acid, ethyl ester
• 1H-Imidazo[4,5-b]pyridine-2-acetic acid, ethyl ester
• Ethyl 3H-imidazo[4,5-b]pyridine-2-acetate
• Ethyl 3H-imidazo[4,5-b]pyridin-2-ylacetate