CAS 107932-99-0

3H-Imidazo[4,5-b]pyridine-2-acetic acid

Description:

3H-Imidazo[4,5-b]pyridine-2-acetic acid is a heterocyclic compound characterized by its fused imidazole and pyridine rings, which contribute to its unique chemical properties. This compound features an acetic acid functional group, enhancing its solubility in polar solvents and potentially influencing its biological activity. The presence of nitrogen atoms in the ring structure can facilitate hydrogen bonding and interactions with biological targets, making it of interest in medicinal chemistry. Its molecular structure suggests potential applications in pharmaceuticals, particularly in the development of compounds with antimicrobial or anti-inflammatory properties. The compound's CAS number, 107932-99-0, allows for easy identification in chemical databases, facilitating research and development efforts. Additionally, the stability and reactivity of 3H-Imidazo[4,5-b]pyridine-2-acetic acid can be influenced by factors such as pH and temperature, which are important considerations in both laboratory and industrial settings. Overall, this compound represents a valuable scaffold for further exploration in drug discovery and development.

Formula: C₈H₇N₃O₂

InChI: InChI=1S/C8H7N3O2/c12-7(13)4-6-10-5-2-1-3-9-8(5)11-6/h1-3H,4H2,(H,12,13)(H,9,10,11)

InChI key: InChIKey=SHCCOLNEBLEONP-UHFFFAOYSA-N

SMILES: C(C(O)=O)C=1NC=2C(N1)=NC=CC2

Synonyms:

• 2-[1H-Imidazo[4,5-b]pyridin-2-yl]acetic acid
• 1H-Imidazo[4,5-b]pyridine-2-acetic acid
• 3H-Imidazo[4,5-b]pyridine-2-acetic acid
• 2-[3H-Imidazo[4,5-b]pyridin-2-yl]acetic acid