CymitQuimica logo

CAS 1079352-16-1

:

Ethyl 6-(difluoromethoxy)-4-methyl-3-pyridinecarboxylate

Description:
Ethyl 6-(difluoromethoxy)-4-methyl-3-pyridinecarboxylate is a chemical compound characterized by its pyridine ring structure, which is a six-membered aromatic ring containing one nitrogen atom. This compound features an ethyl ester functional group, contributing to its reactivity and solubility properties. The presence of a difluoromethoxy group indicates that it contains two fluorine atoms attached to a methoxy group, which can influence its electronic properties and potential interactions in chemical reactions. The methyl group at the 4-position of the pyridine ring adds to the compound's steric and electronic characteristics. This compound may exhibit specific biological activities, making it of interest in pharmaceutical research. Its unique structure suggests potential applications in medicinal chemistry, particularly in the development of new therapeutic agents. As with many organic compounds, its physical properties, such as boiling point, melting point, and solubility, would depend on the molecular interactions and the presence of functional groups. Safety and handling precautions should be observed due to the presence of fluorine, which can impart toxicity and environmental concerns.
Formula:C10H11F2NO3
InChI:InChI=1S/C10H11F2NO3/c1-3-15-9(14)7-5-13-8(4-6(7)2)16-10(11)12/h4-5,10H,3H2,1-2H3
InChI key:InChIKey=HKHFIPBHZOBJDV-UHFFFAOYSA-N
SMILES:C(OCC)(=O)C=1C(C)=CC(OC(F)F)=NC1
Synonyms:
  • 3-Pyridinecarboxylic acid, 6-(difluoromethoxy)-4-methyl-, ethyl ester
  • Ethyl 6-(difluoromethoxy)-4-methyl-3-pyridinecarboxylate
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.