CAS 107946-76-9
:5-(1-Pyrrolidinyl)-3-pyridinecarboxylic acid
Description:
5-(1-Pyrrolidinyl)-3-pyridinecarboxylic acid, with the CAS number 107946-76-9, is a chemical compound characterized by its pyridine and pyrrolidine functional groups. This substance typically appears as a solid and is soluble in polar solvents, reflecting its polar nature due to the presence of the carboxylic acid group. The compound is of interest in medicinal chemistry, often studied for its potential biological activities, including effects on neurotransmitter systems. Its structure allows for various interactions with biological targets, making it a candidate for further research in pharmacology. The presence of both the pyridine and pyrrolidine rings contributes to its unique chemical properties, including its acidity and potential for forming hydrogen bonds. Additionally, the compound may exhibit specific reactivity patterns typical of carboxylic acids, such as esterification or amide formation, which can be exploited in synthetic applications. Overall, 5-(1-Pyrrolidinyl)-3-pyridinecarboxylic acid is a versatile compound with potential implications in drug development and chemical synthesis.
Formula:C10H12N2O2
InChI:InChI=1S/C10H12N2O2/c13-10(14)8-5-9(7-11-6-8)12-3-1-2-4-12/h5-7H,1-4H2,(H,13,14)
InChI key:InChIKey=UGWSMWOVLUKDAT-UHFFFAOYSA-N
SMILES:C(O)(=O)C1=CC(=CN=C1)N2CCCC2
Synonyms:- 5-(1-Pyrrolidinyl)-3-pyridinecarboxylic acid
- 3-Pyridinecarboxylic acid, 5-(1-pyrrolidinyl)-
- 3-(Pyrrolidin-1-yl)pyridine-5-carboxylic acid
- 5-(Pyrrolidin-1-yl)nicotinic acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
