CAS 107955-92-0

N-Hydroxy-α,α-dimethylbenzeneacetamide

Description:

N-Hydroxy-α,α-dimethylbenzeneacetamide, with the CAS number 107955-92-0, is a chemical compound characterized by its unique structural features, including a hydroxylamine functional group attached to a dimethyl-substituted benzene ring and an acetamide moiety. This compound typically exhibits properties associated with both amides and hydroxylamines, such as potential reactivity in nucleophilic substitution reactions and the ability to form hydrogen bonds due to the presence of the hydroxyl group. It may be utilized in various chemical syntheses or as an intermediate in pharmaceutical applications. The presence of the dimethyl groups can influence its steric hindrance and solubility in organic solvents. Additionally, the compound's stability and reactivity can be affected by environmental conditions such as pH and temperature. Safety data sheets should be consulted for handling and storage guidelines, as compounds with similar structures may exhibit varying degrees of toxicity or reactivity. Overall, N-Hydroxy-α,α-dimethylbenzeneacetamide represents a versatile compound in organic chemistry with potential applications in research and industry.

Formula: C₁₀H₁₃NO₂

InChI: InChI=1S/C10H13NO2/c1-10(2,9(12)11-13)8-6-4-3-5-7-8/h3-7,13H,1-2H3,(H,11,12)

InChI key: InChIKey=ZXXJKUBDSHZOAA-UHFFFAOYSA-N

SMILES: C(C(NO)=O)(C)(C)C1=CC=CC=C1

Synonyms:

• Benzeneacetamide, N-hydroxy-α,α-dimethyl-
• N-Hydroxy-α,α-dimethylbenzeneacetamide
• N-hydroxy-2-methyl-2-phenylpropanamide

N-Hydroxy-2-methyl-2-phenylpropanamide

CAS: 107955-92-0

Versatile small molecule scaffold

Formula: C₁₀H₁₃NO₂

Purity: Min. 95%

Molecular weight: 179.22 g/mol

Ref: 3D-HEA95592