CAS 1079656-83-9

(αR)-3-Fluoro-α-methyl-5-(trifluoromethyl)benzenemethanamine

Description:

(αR)-3-Fluoro-α-methyl-5-(trifluoromethyl)benzenemethanamine, with CAS number 1079656-83-9, is a chemical compound characterized by its unique structural features, including a fluorinated aromatic ring and an amine functional group. The presence of a trifluoromethyl group enhances its lipophilicity and may influence its biological activity. This compound is likely to exhibit significant polarity due to the fluorine atoms, which can affect its solubility in various solvents and its interaction with biological systems. The specific stereochemistry indicated by the (αR) designation suggests that it has a defined spatial arrangement, which can be crucial for its pharmacological properties. Such compounds are often of interest in medicinal chemistry for their potential applications in drug development, particularly in targeting specific receptors or enzymes. Additionally, the fluorine substituents can enhance metabolic stability and alter the compound's reactivity, making it a valuable candidate for further research in various chemical and pharmaceutical contexts.

Formula: C₉H₉F₄N

InChI: InChI=1S/C9H9F4N/c1-5(14)6-2-7(9(11,12)13)4-8(10)3-6/h2-5H,14H2,1H3/t5-/m1/s1

InChI key: InChIKey=CYBTYBCFSPUKPL-RXMQYKEDSA-N

SMILES: C(F)(F)(F)C1=CC([C@@H](C)N)=CC(F)=C1

Synonyms:

• (R)-1-[3-Fluoro-5-(trifluoromethyl)phenyl]ethanamine
• (1R)-1-[3-Fluoro-5-(trifluoromethyl)phenyl]ethan-1-amine
• (1r)-1-[3-Fluoro-5-(trifluoromethyl)phenyl]ethanamine
• (αR)-3-Fluoro-α-methyl-5-(trifluoromethyl)benzenemethanamine
• Benzenemethanamine, 3-fluoro-α-methyl-5-(trifluoromethyl)-, (αR)-