CAS 107997-80-8
:5-hydroxyfuran-2-carbaldehyde
Description:
5-Hydroxyfuran-2-carbaldehyde, with the CAS number 107997-80-8, is an organic compound characterized by its furan ring structure, which is a five-membered aromatic ring containing one oxygen atom. This compound features a hydroxyl group (-OH) and an aldehyde group (-CHO) attached to the furan ring, contributing to its reactivity and potential applications in organic synthesis. It is typically a colorless to pale yellow liquid or solid, depending on its purity and form. The presence of the hydroxyl group enhances its solubility in polar solvents, while the aldehyde functionality allows for various chemical reactions, including condensation and oxidation. 5-Hydroxyfuran-2-carbaldehyde is of interest in the fields of medicinal chemistry and materials science, as it can serve as a building block for more complex molecules. Additionally, its unique structure may impart specific biological activities, making it a candidate for further research in drug development and other applications. Safety data should be consulted for handling and storage, as with any chemical substance.
Formula:C5H4O3
InChI:InChI=1/C5H4O3/c6-3-4-1-2-5(7)8-4/h1-3,7H
SMILES:c1cc(O)oc1C=O
Synonyms:- 2-Furancarboxaldehyde, 5-Hydroxy-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.