CymitQuimica logo

CAS 1079991-68-6

:

4-fluoro-2-methyl-3-nitrobenzoic acid

Description:
4-Fluoro-2-methyl-3-nitrobenzoic acid is an aromatic carboxylic acid characterized by the presence of a benzoic acid core substituted with a fluorine atom, a methyl group, and a nitro group. The fluorine atom is located at the para position relative to the carboxylic acid group, while the methyl and nitro groups are positioned at the ortho and meta positions, respectively. This compound exhibits typical properties of benzoic acids, including solubility in organic solvents and moderate solubility in water, influenced by the polar carboxylic acid functional group. The presence of the nitro group contributes to its acidity and potential reactivity, while the fluorine atom can enhance its lipophilicity and influence its biological activity. 4-Fluoro-2-methyl-3-nitrobenzoic acid may be utilized in various chemical syntheses and research applications, particularly in the development of pharmaceuticals and agrochemicals. Its unique substitution pattern can also affect its electronic properties, making it a subject of interest in studies related to molecular interactions and reactivity.
Formula:C8H6FNO4
InChI:InChI=1S/C8H6FNO4/c1-4-5(8(11)12)2-3-6(9)7(4)10(13)14/h2-3H,1H3,(H,11,12)
InChI key:MLCPINGKKONVKT-UHFFFAOYSA-N
SMILES:CC1=C(C=CC(=C1[N+](=O)[O-])F)C(=O)O
Found 4 products.