CAS 108-79-2: 2-Hydroxy-4,6-dimethylpyrimidine
Description:2-Hydroxy-4,6-dimethylpyrimidine, with the CAS number 108-79-2, is an organic compound belonging to the pyrimidine family, characterized by a six-membered aromatic ring containing two nitrogen atoms at positions 1 and 3. This compound features a hydroxyl group (-OH) at the 2-position and two methyl groups (-CH3) at the 4 and 6 positions, contributing to its unique chemical properties. It is typically a white to light yellow crystalline solid, soluble in polar solvents such as water and alcohols, due to the presence of the hydroxyl group. The compound exhibits moderate stability under standard conditions but may undergo reactions typical of pyrimidines, such as nucleophilic substitutions or electrophilic aromatic substitutions. Its hydroxyl group can participate in hydrogen bonding, influencing its reactivity and interactions with other molecules. 2-Hydroxy-4,6-dimethylpyrimidine is of interest in various fields, including pharmaceuticals and agrochemicals, due to its potential biological activities and applications in synthesis.
Formula:C6H8N2O
InChI:InChI=1S/C6H8N2O/c1-4-3-5(2)8-6(9)7-4/h3H,1-2H3,(H,7,8,9)
InChI key:InChIKey=WHEQVHAIRSPYDK-UHFFFAOYSA-N
SMILES:O=C1N=C(C=C(N1)C)C
- Synonyms:
- 2(1H)-Pyrimidinone, 4,6-dimethyl-
- 2(1H)-Pyrimidone, 4,6-dimethyl-
- 2-Hydroxy-4,6-dimethylpyrimidine
- 2-Pyrimidinol, 4,6-dimethyl-
- 4,6-Dimethyl-1,2-dihydro-2-pyrimidone
- 4,6-Dimethyl-1,2-dihydropyrimidin-2-one
- 4,6-Dimethyl-2(1H)-Pyrimidinon
- 4,6-Dimethyl-2(1H)-pyrimidinone
- 4,6-Dimethyl-2(1H)-pyrimidone
- 4,6-Dimethyl-2(3H)-pyrimidinone
- See more synonyms
- 4,6-Dimethyl-2-pyrimidone
- 4,6-dimethyl-2-PYRIMIDINOL
- 4,6-dimethylpyrimidin-2(1H)-one
- 4,6-dimethylpyrimidin-2-OL