CAS 1080-12-2: vanillylidene acetone
Description:Vanillylidene acetone, with the CAS number 1080-12-2, is an organic compound characterized by its distinctive structure, which features a vanillin-derived moiety linked to an acetone group. This compound typically appears as a yellowish to brownish liquid or solid, depending on its purity and conditions. It is known for its aromatic properties, contributing to its use in flavoring and fragrance applications. Vanillylidene acetone exhibits a range of functional groups, including an aldehyde and a ketone, which influence its reactivity and interactions with other substances. The compound is soluble in organic solvents, making it versatile in various chemical reactions, including condensation and polymerization processes. Additionally, it has been studied for its potential biological activities, including antioxidant and antimicrobial properties. However, safety data should be consulted, as it may pose health risks if not handled properly. Overall, vanillylidene acetone is a compound of interest in both industrial and research settings due to its unique chemical characteristics and potential applications.
Formula:C11H12O3
InChI:InChI=1S/C11H12O3/c1-8(12)3-4-9-5-6-10(13)11(7-9)14-2/h3-7,13H,1-2H3
InChI key:InChIKey=AFWKBSMFXWNGRE-UHFFFAOYSA-N
SMILES:O=C(C=CC1=CC=C(O)C(OC)=C1)C
- Synonyms:
- Feruloylmethane
- 4-(4-Hydroxy-3-methoxyphenyl)-3-buten-2-one
- 3-Buten-2-one, 4-(4-hydroxy-3-methoxyphenyl)-
- Dehydrozingerone
- 3-Methoxy-4-hydroxybenzalacetone
