CAS 1080-43-9
:Dimethyldiphenyltin
Description:
Dimethyldiphenyltin, with the CAS number 1080-43-9, is an organotin compound characterized by its structure, which includes two methyl groups and two phenyl groups attached to a tin atom. This compound typically appears as a colorless to pale yellow liquid or solid, depending on its form and purity. It is known for its applications as a stabilizer in PVC and as a biocide in various industrial applications. Dimethyldiphenyltin exhibits moderate toxicity, and its handling requires caution due to potential environmental and health impacts. It is relatively stable under normal conditions but can decompose upon exposure to heat or strong acids, releasing toxic tin oxides. The compound is soluble in organic solvents but has limited solubility in water. Its chemical behavior is influenced by the presence of the tin atom, which can form coordination complexes with various ligands. Overall, dimethyldiphenyltin is significant in industrial chemistry, particularly in polymer production and as a fungicide.
Formula:C14H16Sn
InChI:InChI=1/2C6H5.2CH3.Sn/c2*1-2-4-6-5-3-1;;;/h2*1-5H;2*1H3;/rC14H16Sn/c1-15(2,13-9-5-3-6-10-13)14-11-7-4-8-12-14/h3-12H,1-2H3
SMILES:C[Sn](C)(c1ccccc1)c1ccccc1
Synonyms:- Dimethyldiphenyltincolorlessliq
- Dimethyl(Diphenyl)Stannane
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.
Dimethyldiphenyltin
CAS:Dimethyldiphenyltin
Formula:(CH3)2Sn(C6H5)2Color and Shape:colorless liq.Molecular weight:302.97

