CAS 1080-83-7

2-(2-methyl-1H-indol-3-yl)-2-oxoacetamide

Description:

2-(2-methyl-1H-indol-3-yl)-2-oxoacetamide, with the CAS number 1080-83-7, is an organic compound characterized by its indole structure, which is a bicyclic compound consisting of a benzene ring fused to a pyrrole ring. This compound features a ketone functional group (the 2-oxo group) and an amide linkage, which contributes to its reactivity and potential biological activity. It is typically a solid at room temperature and may exhibit moderate solubility in polar organic solvents. The presence of the indole moiety suggests potential applications in medicinal chemistry, as indole derivatives are known for their diverse pharmacological properties. Additionally, the methyl group on the indole ring can influence the compound's electronic properties and steric hindrance, affecting its interactions with biological targets. Overall, 2-(2-methyl-1H-indol-3-yl)-2-oxoacetamide is of interest for further research in drug development and synthetic chemistry due to its unique structural features.

Formula: C₁₁H₁₀N₂O₂

InChI: InChI=1/C11H10N2O2/c1-6-9(10(14)11(12)15)7-4-2-3-5-8(7)13-6/h2-5,13H,1H3,(H2,12,15)

Synonyms:

• 1H-indole-3-acetamide, 2-methyl-alpha-oxo-