CymitQuimica logo

CAS 108001-76-9

:

4-(HYDROXY)PIPERIDINE-1-CARBOXAMIDINE

Description:
4-(Hydroxy)piperidine-1-carboxamidine, with the CAS number 108001-76-9, is a chemical compound characterized by its piperidine ring structure, which is a six-membered saturated heterocycle containing one nitrogen atom. The presence of a hydroxyl group (-OH) at the fourth position and a carboxamidine functional group (-C(=NH)NH2) at the first position contributes to its unique reactivity and potential biological activity. This compound is typically a white to off-white solid and is soluble in polar solvents due to the presence of the hydroxyl and amine groups. It may exhibit properties such as being a potential intermediate in organic synthesis or a candidate for pharmaceutical applications, particularly in the development of drugs targeting various biological pathways. Its specific interactions and stability can be influenced by factors such as pH and temperature, making it important to consider these conditions in practical applications. As with many chemical substances, safety data sheets should be consulted for handling and toxicity information.
Formula:C6H14IN3O
InChI:InChI=1/C6H13N3O.HI/c7-6(8)9-3-1-5(10)2-4-9;/h5,10H,1-4H2,(H3,7,8);1H
SMILES:C1CN(CCC1O)C(=N)N.I
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.