CAS 1080028-75-6

2-(Phenylamino)-5-pyrimidinecarboxaldehyde

Description:

2-(Phenylamino)-5-pyrimidinecarboxaldehyde is an organic compound characterized by its pyrimidine ring structure, which is substituted with both a phenylamino group and an aldehyde functional group. This compound typically exhibits a pale yellow to light brown appearance and is soluble in polar organic solvents. The presence of the aldehyde group contributes to its reactivity, allowing it to participate in various chemical reactions, such as condensation and nucleophilic addition. The phenylamino substituent can influence the compound's electronic properties, potentially enhancing its reactivity and interaction with biological targets. This compound may be of interest in medicinal chemistry and material science due to its potential applications in drug development and as a building block for more complex molecules. Additionally, its structural features may allow for specific interactions with biological macromolecules, making it a candidate for further investigation in pharmacological studies. As with many organic compounds, safety precautions should be observed when handling it, given the potential for toxicity and reactivity.

Formula: C₁₁H₉N₃O

InChI: InChI=1S/C11H9N3O/c15-8-9-6-12-11(13-7-9)14-10-4-2-1-3-5-10/h1-8H,(H,12,13,14)

InChI key: InChIKey=QNFHXIZSGIGYOU-UHFFFAOYSA-N

SMILES: N(C=1N=CC(C=O)=CN1)C2=CC=CC=C2

Synonyms:

• 5-Pyrimidinecarboxaldehyde, 2-(phenylamino)-
• 2-(Phenylamino)-5-pyrimidinecarboxaldehyde