CAS 108008-61-3
:5-(2-fluoroethyl)-1-[(2R,4S,5R)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl ]pyrimidine-2,4-dione
Description:
5-(2-Fluoroethyl)-1-[(2R,4S,5R)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]pyrimidine-2,4-dione, with CAS number 108008-61-3, is a chemical compound that belongs to the class of pyrimidine derivatives. This substance features a pyrimidine ring substituted with a fluoroethyl group and a sugar moiety, specifically a modified ribose structure, which contributes to its biological activity. The presence of hydroxyl groups enhances its solubility and potential interactions with biological targets. This compound is of interest in medicinal chemistry, particularly in the development of antiviral or anticancer agents, due to its structural similarity to nucleosides. Its stereochemistry, indicated by the specific configuration of the sugar moiety, plays a crucial role in its biological function and interaction with enzymes. The compound's stability, reactivity, and pharmacokinetic properties are influenced by its functional groups and overall molecular structure, making it a subject of research in drug design and development.
Formula:C11H15FN2O5
InChI:InChI=1/C11H15FN2O5/c12-2-1-6-4-14(11(18)13-10(6)17)9-3-7(16)8(5-15)19-9/h4,7-9,15-16H,1-3,5H2,(H,13,17,18)/t7-,8+,9+/m0/s1
Synonyms:- 5-(2-Fluoroethyl)-2'-Deoxyuridine
- 2'-Deoxy-5-(2-Fluoroethyl)Uridine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
5-(2-Fluoroethyl)-2'-deoxyuridine
CAS:Controlled ProductFormula:C11H15FN2O5Color and Shape:NeatMolecular weight:274.246
