CAS 108008-64-6

5-(2-fluoroethyl)-2'-fluoroarabinofuranosyluracil

Description:

5-(2-Fluoroethyl)-2'-fluoroarabinofuranosyluracil, with the CAS number 108008-64-6, is a synthetic nucleoside analog that incorporates fluorine substituents, which can enhance its biological activity and stability. This compound features a uracil base linked to an arabinofuranosyl sugar moiety, modified by the presence of a 2-fluoroethyl group at the 5-position of the uracil ring and a fluorine atom at the 2' position of the sugar. These modifications can influence the compound's interaction with nucleic acid synthesis and its potential as an antiviral or anticancer agent. The presence of fluorine atoms typically enhances lipophilicity and metabolic stability, potentially improving the pharmacokinetic properties of the compound. Additionally, the structural characteristics suggest that it may exhibit unique binding affinities to nucleic acid targets, making it a subject of interest in medicinal chemistry and drug development. Its specific biological activity, toxicity, and therapeutic potential would require further investigation through experimental studies.

Formula: C₁₁H₁₄F₂N₂O₅

InChI: InChI=1/C11H14F2N2O5/c12-2-1-5-3-15(11(19)14-9(5)18)10-7(13)8(17)6(4-16)20-10/h3,6-8,10,16-17H,1-2,4H2,(H,14,18,19)/t6-,7+,8-,10-/m1/s1

Synonyms:

• Fefau
• 2,4(1H,3H)-Pyrimidinedione, 1-(2-deoxy-2-fluoro-beta-D-arabinofuranosyl)-5-(2-fluoroethyl)-
• Uracil, 5-(2-fluoroethyl)-2'-fluoroarabinofuranosyl-
• 1-(2-deoxy-2-fluoro-beta-D-arabinofuranosyl)-5-(2-fluoroethyl)pyrimidine-2,4(1H,3H)-dione