
CAS 108030-77-9
:Penclomedine
Description:
Penclomedine is a synthetic compound primarily studied for its potential use in cancer therapy. It belongs to the class of compounds known as indole derivatives and exhibits a unique mechanism of action that involves the disruption of DNA synthesis in cancer cells. This compound is characterized by its ability to interfere with cellular processes, leading to apoptosis in malignant cells. Penclomedine is typically administered in a clinical setting and has been evaluated for its efficacy against various types of tumors, including those resistant to conventional therapies. Its pharmacokinetics indicate moderate absorption and distribution in the body, with a metabolism that may involve hepatic pathways. The compound's safety profile is still under investigation, with ongoing studies aimed at determining optimal dosing regimens and potential side effects. Overall, penclomedine represents a promising avenue in oncological research, contributing to the development of targeted therapies for cancer treatment.
Formula:C8H6Cl5NO2
InChI:InChI=1S/C8H6Cl5NO2/c1-15-5-3(9)6(8(11,12)13)14-7(16-2)4(5)10/h1-2H3
InChI key:InChIKey=DZVPGIORVGSQMC-UHFFFAOYSA-N
SMILES:C(Cl)(Cl)(Cl)C1=C(Cl)C(OC)=C(Cl)C(OC)=N1
Synonyms:- 3,5-Dichloro-2,4-dimethoxy-6-(trichloromethyl)pyridine
- PEN
- Pyridine, 3,5-dichloro-2,4-dimethoxy-6-(trichloromethyl)-
- NSC 338720
- Penclomedine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Penclomedine
CAS:Penclomedine is an antineoplastic agent which alkylates and crosslinks DNA, resulting in DNA strand breaks and inhibition of DNA and RNA synthesis.Formula:C8H6Cl5NO2Color and Shape:SolidMolecular weight:325.4
