
CAS 108030-82-6
:2-(3-Chlorophenyl)pyrazine
Description:
2-(3-Chlorophenyl)pyrazine is an organic compound characterized by its pyrazine ring, which is a six-membered aromatic heterocycle containing two nitrogen atoms at opposite positions. The presence of a 3-chlorophenyl group indicates that a chlorine atom is substituted on the phenyl ring at the meta position relative to the point of attachment to the pyrazine. This compound typically exhibits properties such as moderate solubility in organic solvents and potential reactivity due to the electron-withdrawing nature of the chlorine substituent, which can influence its chemical behavior in various reactions. It may also display biological activity, making it of interest in pharmaceutical research. The molecular structure contributes to its unique physical and chemical properties, including its melting point, boiling point, and spectral characteristics, which can be analyzed using techniques like NMR and mass spectrometry. Overall, 2-(3-Chlorophenyl)pyrazine is a compound of interest in both synthetic organic chemistry and medicinal chemistry due to its structural features and potential applications.
Formula:C10H7ClN2
InChI:InChI=1S/C10H7ClN2/c11-9-3-1-2-8(6-9)10-7-12-4-5-13-10/h1-7H
InChI key:InChIKey=UGZZOTWFHDPYEF-UHFFFAOYSA-N
SMILES:ClC=1C=C(C=CC1)C=2C=NC=CN2
Synonyms:- Pyrazine, (3-chlorophenyl)-
- 2-(3-Chlorophenyl)pyrazine
- Pyrazine, 2-(3-chlorophenyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.