CAS 108035-45-6

4-(1H-IMIDAZOL-2-YL)-BENZOIC ACID

Description:

4-(1H-Imidazol-2-yl)-benzoic acid, with the CAS number 108035-45-6, is an organic compound characterized by its dual functional groups: a benzoic acid moiety and an imidazole ring. This compound typically appears as a white to off-white solid and is soluble in polar solvents such as water and alcohols, owing to the presence of the carboxylic acid group. The imidazole ring contributes to its potential biological activity, making it of interest in medicinal chemistry and pharmacology. The compound may exhibit properties such as antimicrobial or antifungal activity, which can be attributed to the imidazole's ability to coordinate with metal ions and interact with biological targets. Additionally, its structural features allow for potential applications in drug design, particularly in the development of compounds that target specific enzymes or receptors. Overall, 4-(1H-imidazol-2-yl)-benzoic acid is a versatile compound with significant implications in both research and therapeutic contexts.

Formula: C₁₀H₈N₂O₂

InChI: InChI=1/C10H8N2O2/c13-10(14)8-3-1-7(2-4-8)9-11-5-6-12-9/h1-6H,(H,11,12)(H,13,14)

SMILES: c1cc(ccc1c1[nH]ccn1)C(=O)O

Synonyms:

• Benzoic acid, 4-(1H-imidazol-2-yl)-
• 4-(1H-Imidazol-2-yl)benzoic acid

4-(1H-Imidazol-2-yl)benzoic acid

CAS: 108035-45-6

Formula: C₁₀H₈N₂O₂

Purity: 97%

Color and Shape: Solid

Molecular weight: 188.1827

Ref: IN-DA003K00

4-(1H-Imidazol-2-yl)benzoic acid

CAS: 108035-45-6

4-(1H-Imidazol-2-yl)benzoic acid

Purity: 98%

Molecular weight: 188.18g/mol

Ref: 54-OR953354

4-(1H-Imidazol-2-yl)-benzoic acid

CAS: 108035-45-6

Formula: C₁₀H₈N₂O₂

Purity: 97%

Color and Shape: Solid

Molecular weight: 188.186

Ref: 10-F046351