CAS 108035-47-8

3-(1H-IMIDAZOL-1-YL)BENZOIC ACID

Description:

3-(1H-Imidazol-1-yl)benzoic acid, with the CAS number 108035-47-8, is an organic compound characterized by the presence of both an imidazole ring and a carboxylic acid functional group. This compound features a benzoic acid moiety, where the carboxylic acid group is attached to a benzene ring, and an imidazole group is substituted at the meta position. The imidazole ring contributes to its potential biological activity, making it of interest in medicinal chemistry. The compound is typically a solid at room temperature and may exhibit moderate solubility in polar solvents due to the presence of the carboxylic acid group. Its properties, such as melting point, boiling point, and solubility, can vary based on purity and environmental conditions. Additionally, 3-(1H-imidazol-1-yl)benzoic acid may participate in various chemical reactions, including esterification and amidation, making it a versatile building block in organic synthesis and pharmaceutical development.

Formula: C₁₀H₈N₂O₂

InChI: InChI=1/C10H8N2O2/c13-10(14)8-2-1-3-9(6-8)12-5-4-11-7-12/h1-7H,(H,13,14)

SMILES: c1cc(cc(c1)n1ccnc1)C(=O)O

Synonyms:

• 3-Imidazol-1-Yl-Benzoic Acid
• 3-(1H-Imidazol-1-yl)benzoic acid 97%

3-(1H-Imidazol-1-yl)benzoic acid

CAS: 108035-47-8

Formula: C₁₀H₈N₂O₂

Purity: 98%

Color and Shape: Solid

Molecular weight: 188.1827

Ref: IN-DA003HZK

3-(1H-Imidazol-1-yl)benzoic acid

CAS: 108035-47-8

3-(1H-Imidazol-1-yl)benzoic acid

Formula: C₁₀H₈N₂O₂

Purity: 98%

Color and Shape: pale yellow solid

Molecular weight: 188.18g/mol

Ref: 54-OR9721

3-(1H-Imidazol-1-yl)benzoic acid

CAS: 108035-47-8

Formula: C₁₀H₈N₂O₂

Purity: 98%

Molecular weight: 188.186

Ref: 10-F065729

3-(1H-Imidazol-1-yl)benzoic acid

CAS: 108035-47-8

3-(1H-Imidazol-1-yl)benzoic acid is a heterocyclic organic compound that is used as an excitatory neurotransmitter. It has a high affinity for the metabotropic glutamate receptor and is able to induce excitatory postsynaptic potentials in neurons. 3-(1H-Imidazol-1-yl)benzoic acid binds to the postsynaptic membrane and blocks the ion channels, leading to depolarization of the neuron membrane. The glutamate binding site on the metabotropic glutamate receptor is low nanomolar and five membered, making it a competitive antagonist at this site.

Formula: C₁₀H₈N₂O₂

Purity: Min. 95%

Molecular weight: 188.19 g/mol

Ref: 3D-IEA03547