CAS 108043-88-5

2-Amino-3,6-dihydro-3-methyl-7H-imidazo[4,5-f]quinolin-7-one

Description:

2-Amino-3,6-dihydro-3-methyl-7H-imidazo[4,5-f]quinolin-7-one is a heterocyclic compound characterized by its complex bicyclic structure, which includes an imidazole and quinoline moiety. This compound features an amino group and a methyl group, contributing to its reactivity and potential biological activity. It is typically a solid at room temperature and may exhibit moderate solubility in polar solvents due to the presence of the amino group. The compound is of interest in medicinal chemistry, particularly for its potential pharmacological properties, including antimicrobial and anticancer activities. Its structure allows for various interactions with biological targets, making it a candidate for further research in drug development. Additionally, the presence of nitrogen atoms in the ring structure can influence its electronic properties and reactivity, which are crucial for its function in biological systems. As with many heterocycles, the stability and reactivity of this compound can be influenced by environmental factors such as pH and temperature.

Formula: C₁₁H₁₀N₄O

InChI: InChI=1/C11H10N4O/c1-15-8-4-3-7-6(2-5-9(16)13-7)10(8)14-11(15)12/h2-5H,1H3,(H2,12,14)(H,13,16)

SMILES: Cn1c2ccc3c(ccc(n3)O)c2[nH]c1=N

Synonyms:

• 7-Hydroxy-IQ
• 7-Oh-Iq
• 7-Oxo-IQ
• Hoiq
• Nsc 623628
• 2-amino-3,6-dihydro-3-methyl-7H-imidazo(4,5-f)quinoline-7-one
• 2-amino-3-methyl-3,6-dihydro-7H-imidazo[4,5-f]quinolin-7-one