CAS 108046-14-6
:2,2,2-TRIFLUORO-N-(6-OXO-5,6-DIHYDRO-4H-CYCLOPENTA[B]THIOPHEN-4-YL)ACETAMIDE
Description:
2,2,2-Trifluoro-N-(6-oxo-5,6-dihydro-4H-cyclopenta[b]thiophen-4-yl)acetamide, with CAS number 108046-14-6, is a chemical compound characterized by its unique structure that includes a trifluoroacetyl group and a cyclopentathiophene moiety. This compound features a trifluoromethyl group, which imparts significant electronegativity and lipophilicity, influencing its reactivity and solubility in organic solvents. The presence of the 6-oxo group contributes to its potential as a bioactive molecule, possibly exhibiting pharmacological properties. The cyclopentathiophene structure may enhance its stability and interaction with biological targets. This compound is likely to be of interest in medicinal chemistry and materials science due to its potential applications in drug development and organic electronics. Its synthesis and characterization would typically involve standard organic reactions, and its properties can be further explored through various analytical techniques such as NMR, mass spectrometry, and IR spectroscopy. Safety and handling precautions should be observed due to the presence of fluorinated groups, which can pose environmental and health risks.
Formula:C9H6F3NO2S
InChI:InChI=1/C9H6F3NO2S/c10-9(11,12)8(15)13-5-3-6(14)7-4(5)1-2-16-7/h1-2,5H,3H2,(H,13,15)/t5-/m1/s1
SMILES:c1csc2c1[C@@H](CC2=O)N=C(C(F)(F)F)O
Synonyms:- 2,2,2-trifluoro-N-[(4S)-6-oxo-5,6-dihydro-4H-cyclopenta[b]thiophen-4-yl]acetamide
- 2,2,2-trifluoro-N-[(4R)-6-oxo-5,6-dihydro-4H-cyclopenta[b]thiophen-4-yl]acetamide
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
2,2,2-Trifluoro-N-(5,6-dihydro-6-oxo-4H-cyclopenta[b]thiophen-4-yl)acetamide
CAS:<p>2,2,2-Trifluoro-N-(5,6-dihydro-6-oxo-4H-cyclopenta[b]thiophen-4-yl)acetamide</p>Molecular weight:249.21g/mol
